C34H52O6Si3 — CID 69434547
[6-[dimethoxy(phenyl)silyl]-4-[2-[dimethoxy(phenyl)silyl]propyl]heptan-2-yl]-dimethoxy-phenylsilane (PubChem CID 69434547) has the molecular formula C34H52O6Si3 and a molecular weight of 641.04 g/mol. Its IUPAC name is [6-[dimethoxy(phenyl)silyl]-4-[2-[dimethoxy(phenyl)silyl]propyl]heptan-2-yl]-dimethoxy-phenylsilane.
| Compound Name | [6-[dimethoxy(phenyl)silyl]-4-[2-[dimethoxy(phenyl)silyl]propyl]heptan-2-yl]-dimethoxy-phenylsilane |
|---|---|
| PubChem CID | 69434547 |
| Molecular Formula | C34H52O6Si3 |
| Molecular Weight | 641.04 g/mol |
| Exact Mass | 640.31 |
| IUPAC Name | [6-[dimethoxy(phenyl)silyl]-4-[2-[dimethoxy(phenyl)silyl]propyl]heptan-2-yl]-dimethoxy-phenylsilane |
| SMILES | CO[Si](OC)(c1ccccc1)C(C)CC(CC(C)[Si](OC)(OC)c1ccccc1)CC(C)[Si](OC)(OC)c1ccccc1 |
| InChI | InChI=1S/C34H52O6Si3/c1-28(41(35-4,36-5)32-19-13-10-14-20-32)25-31(26-29(2)42(37-6,38-7)33-21-15-11-16-22-33)27-30(3)43(39-8,40-9)34-23-17-12-18-24-34/h10-24,28-31H,25-27H2,1-9H3 |
| InChIKey | SPLANJSLSSRKHZ-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.04 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|