C41H60O8Si4 — CID 69429750
[5-[dimethoxy(phenyl)silyl]-3,3-bis[2-[dimethoxy(phenyl)silyl]ethyl]pentyl]-dimethoxy-phenylsilane (PubChem CID 69429750) has the molecular formula C41H60O8Si4 and a molecular weight of 793.27 g/mol. Its IUPAC name is [5-[dimethoxy(phenyl)silyl]-3,3-bis[2-[dimethoxy(phenyl)silyl]ethyl]pentyl]-dimethoxy-phenylsilane.
| Compound Name | [5-[dimethoxy(phenyl)silyl]-3,3-bis[2-[dimethoxy(phenyl)silyl]ethyl]pentyl]-dimethoxy-phenylsilane |
|---|---|
| PubChem CID | 69429750 |
| Molecular Formula | C41H60O8Si4 |
| Molecular Weight | 793.27 g/mol |
| Exact Mass | 792.34 |
| IUPAC Name | [5-[dimethoxy(phenyl)silyl]-3,3-bis[2-[dimethoxy(phenyl)silyl]ethyl]pentyl]-dimethoxy-phenylsilane |
| SMILES | CO[Si](CCC(CC[Si](OC)(OC)c1ccccc1)(CC[Si](OC)(OC)c1ccccc1)CC[Si](OC)(OC)c1ccccc1)(OC)c1ccccc1 |
| InChI | InChI=1S/C41H60O8Si4/c1-42-50(43-2,37-21-13-9-14-22-37)33-29-41(30-34-51(44-3,45-4)38-23-15-10-16-24-38,31-35-52(46-5,47-6)39-25-17-11-18-26-39)32-36-53(48-7,49-8)40-27-19-12-20-28-40/h9-28H,29-36H2,1-8H3 |
| InChIKey | RSMUMVNGJSMDRU-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.27 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|