C34H44O6Si3 — CID 90761727
[3,5-bis[[dimethoxy(phenyl)silyl]methyl]-2-methylphenyl]methyl-dimethoxy-phenylsilane (PubChem CID 90761727) has the molecular formula C34H44O6Si3 and a molecular weight of 632.98 g/mol. Its IUPAC name is [3,5-bis[[dimethoxy(phenyl)silyl]methyl]-2-methylphenyl]methyl-dimethoxy-phenylsilane.
| Compound Name | [3,5-bis[[dimethoxy(phenyl)silyl]methyl]-2-methylphenyl]methyl-dimethoxy-phenylsilane |
|---|---|
| PubChem CID | 90761727 |
| Molecular Formula | C34H44O6Si3 |
| Molecular Weight | 632.98 g/mol |
| Exact Mass | 632.24 |
| IUPAC Name | [3,5-bis[[dimethoxy(phenyl)silyl]methyl]-2-methylphenyl]methyl-dimethoxy-phenylsilane |
| SMILES | CO[Si](Cc1cc(C[Si](OC)(OC)c2ccccc2)c(C)c(C[Si](OC)(OC)c2ccccc2)c1)(OC)c1ccccc1 |
| InChI | InChI=1S/C34H44O6Si3/c1-28-30(26-42(37-4,38-5)33-19-13-9-14-20-33)23-29(25-41(35-2,36-3)32-17-11-8-12-18-32)24-31(28)27-43(39-6,40-7)34-21-15-10-16-22-34/h8-24H,25-27H2,1-7H3 |
| InChIKey | WIRDFJAHPPEOHV-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.98 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|