C53H84O8Si4 — CID 87833172
[11-[dimethoxy(phenyl)silyl]-6,6-bis[5-[dimethoxy(phenyl)silyl]pentyl]undecyl]-dimethoxy-phenylsilane (PubChem CID 87833172) has the molecular formula C53H84O8Si4 and a molecular weight of 961.59 g/mol. Its IUPAC name is [11-[dimethoxy(phenyl)silyl]-6,6-bis[5-[dimethoxy(phenyl)silyl]pentyl]undecyl]-dimethoxy-phenylsilane.
| Compound Name | [11-[dimethoxy(phenyl)silyl]-6,6-bis[5-[dimethoxy(phenyl)silyl]pentyl]undecyl]-dimethoxy-phenylsilane |
|---|---|
| PubChem CID | 87833172 |
| Molecular Formula | C53H84O8Si4 |
| Molecular Weight | 961.59 g/mol |
| Exact Mass | 960.52 |
| IUPAC Name | [11-[dimethoxy(phenyl)silyl]-6,6-bis[5-[dimethoxy(phenyl)silyl]pentyl]undecyl]-dimethoxy-phenylsilane |
| SMILES | CO[Si](CCCCCC(CCCCC[Si](OC)(OC)c1ccccc1)(CCCCC[Si](OC)(OC)c1ccccc1)CCCCC[Si](OC)(OC)c1ccccc1)(OC)c1ccccc1 |
| InChI | InChI=1S/C53H84O8Si4/c1-54-62(55-2,49-33-17-9-18-34-49)45-29-13-25-41-53(42-26-14-30-46-63(56-3,57-4)50-35-19-10-20-36-50,43-27-15-31-47-64(58-5,59-6)51-37-21-11-22-38-51)44-28-16-32-48-65(60-7,61-8)52-39-23-12-24-40-52/h9-12,17-24,33-40H,13-16,25-32,41-48H2,1-8H3 |
| InChIKey | JNWOAPPUBCQTDU-UHFFFAOYSA-N |
| XLogP | 10.78 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 961.59 |
| LogP ≤ 5 | 10.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|