C21H17NO3S2 — CID 69434555
1-[5-[2-(4-phenoxyphenoxy)-1,3-thiazol-5-yl]thiophen-2-yl]ethanol (PubChem CID 69434555) has the molecular formula C21H17NO3S2 and a molecular weight of 395.51 g/mol. Its IUPAC name is 1-[5-[2-(4-phenoxyphenoxy)-1,3-thiazol-5-yl]thiophen-2-yl]ethanol.
| Compound Name | 1-[5-[2-(4-phenoxyphenoxy)-1,3-thiazol-5-yl]thiophen-2-yl]ethanol |
|---|---|
| PubChem CID | 69434555 |
| Molecular Formula | C21H17NO3S2 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | 1-[5-[2-(4-phenoxyphenoxy)-1,3-thiazol-5-yl]thiophen-2-yl]ethanol |
| SMILES | CC(O)c1ccc(-c2cnc(Oc3ccc(Oc4ccccc4)cc3)s2)s1 |
| InChI | InChI=1S/C21H17NO3S2/c1-14(23)18-11-12-19(26-18)20-13-22-21(27-20)25-17-9-7-16(8-10-17)24-15-5-3-2-4-6-15/h2-14,23H,1H3 |
| InChIKey | BADGRVVMFKMDCA-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |