C19H27N3O2 — CID 69436428
cis-(1S,3R)-3-[4-methyl-1-(oxan-2-yl)indazol-5-yl]oxycyclohexan-1-amine (PubChem CID 69436428) has the molecular formula C19H27N3O2 and a molecular weight of 329.44 g/mol. Its IUPAC name is cis-(1S,3R)-3-[4-methyl-1-(oxan-2-yl)indazol-5-yl]oxycyclohexan-1-amine.
| Compound Name | cis-(1S,3R)-3-[4-methyl-1-(oxan-2-yl)indazol-5-yl]oxycyclohexan-1-amine |
|---|---|
| PubChem CID | 69436428 |
| Molecular Formula | C19H27N3O2 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | cis-(1S,3R)-3-[4-methyl-1-(oxan-2-yl)indazol-5-yl]oxycyclohexan-1-amine |
| SMILES | Cc1c(O[C@@H]2CCC[C@H](N)C2)ccc2c1cnn2C1CCCCO1 |
| InChI | InChI=1S/C19H27N3O2/c1-13-16-12-21-22(19-7-2-3-10-23-19)17(16)8-9-18(13)24-15-6-4-5-14(20)11-15/h8-9,12,14-15,19H,2-7,10-11,20H2,1H3/t14-,15+,19?/m0/s1 |
| InChIKey | JFTXROJYIPRPAT-FPHLKLNRSA-N |
| XLogP | 3.69 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |