C13H18N6O6 — CID 69438935
[[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]-ethylcarbamic acid (PubChem CID 69438935) has the molecular formula C13H18N6O6 and a molecular weight of 354.32 g/mol. Its IUPAC name is [[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]-ethylcarbamic acid.
| Compound Name | [[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]-ethylcarbamic acid |
|---|---|
| PubChem CID | 69438935 |
| Molecular Formula | C13H18N6O6 |
| Molecular Weight | 354.32 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | [[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]-ethylcarbamic acid |
| SMILES | CCN(Nc1ncnc2c1ncn2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O)C(=O)O |
| InChI | InChI=1S/C13H18N6O6/c1-2-19(13(23)24)17-10-7-11(15-4-14-10)18(5-16-7)12-9(22)8(21)6(3-20)25-12/h4-6,8-9,12,20-22H,2-3H2,1H3,(H,23,24)(H,14,15,17)/t6-,8-,9-,12-/m1/s1 |
| InChIKey | PJVWTMCQGUZWKQ-WOUKDFQISA-N |
| XLogP | -1.24 |
| TPSA | 166.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.32 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|