C16H12F4N4O — CID 69439691
1-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-1-(1H-indazol-4-yl)urea (PubChem CID 69439691) has the molecular formula C16H12F4N4O and a molecular weight of 352.29 g/mol. Its IUPAC name is 1-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-1-(1H-indazol-4-yl)urea.
| Compound Name | 1-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-1-(1H-indazol-4-yl)urea |
|---|---|
| PubChem CID | 69439691 |
| Molecular Formula | C16H12F4N4O |
| Molecular Weight | 352.29 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | 1-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-1-(1H-indazol-4-yl)urea |
| SMILES | NC(=O)N(Cc1cc(F)cc(C(F)(F)F)c1)c1cccc2[nH]ncc12 |
| InChI | InChI=1S/C16H12F4N4O/c17-11-5-9(4-10(6-11)16(18,19)20)8-24(15(21)25)14-3-1-2-13-12(14)7-22-23-13/h1-7H,8H2,(H2,21,25)(H,22,23) |
| InChIKey | SWTGDJDTHNIUPK-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.29 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |