C22H24F2N2O6 — CID 69439800
methyl (2S)-2-[[4-(3,4-difluorophenyl)-2-nitrobenzoyl]amino]-3-[(2-methylpropan-2-yl)oxy]butanoate (PubChem CID 69439800) has the molecular formula C22H24F2N2O6 and a molecular weight of 450.44 g/mol. Its IUPAC name is methyl (2S)-2-[[4-(3,4-difluorophenyl)-2-nitrobenzoyl]amino]-3-[(2-methylpropan-2-yl)oxy]butanoate.
| Compound Name | methyl (2S)-2-[[4-(3,4-difluorophenyl)-2-nitrobenzoyl]amino]-3-[(2-methylpropan-2-yl)oxy]butanoate |
|---|---|
| PubChem CID | 69439800 |
| Molecular Formula | C22H24F2N2O6 |
| Molecular Weight | 450.44 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | methyl (2S)-2-[[4-(3,4-difluorophenyl)-2-nitrobenzoyl]amino]-3-[(2-methylpropan-2-yl)oxy]butanoate |
| SMILES | COC(=O)[C@@H](NC(=O)c1ccc(-c2ccc(F)c(F)c2)cc1[N+](=O)[O-])C(C)OC(C)(C)C |
| InChI | InChI=1S/C22H24F2N2O6/c1-12(32-22(2,3)4)19(21(28)31-5)25-20(27)15-8-6-14(11-18(15)26(29)30)13-7-9-16(23)17(24)10-13/h6-12,19H,1-5H3,(H,25,27)/t12?,19-/m0/s1 |
| InChIKey | OUBJEVBZLJFSLF-RKLCOFROSA-N |
| XLogP | 4.01 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.44 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|