C22H30N8O3 — CID 69444545
9-(2,2-dimethylpropyl)-6-[2-(2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl)-2-oxoethyl]-7,8-dihydro-5H-pyrimido[4,5-e][1,4]diazepine-2-carbonitrile (PubChem CID 69444545) has the molecular formula C22H30N8O3 and a molecular weight of 454.54 g/mol. Its IUPAC name is 9-(2,2-dimethylpropyl)-6-[2-(2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl)-2-oxoethyl]-7,8-dihydro-5H-pyrimido[4,5-e][1,4]diazepine-2-carbonitrile.
| Compound Name | 9-(2,2-dimethylpropyl)-6-[2-(2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl)-2-oxoethyl]-7,8-dihydro-5H-pyrimido[4,5-e][1,4]diazepine-2-carbonitrile |
|---|---|
| PubChem CID | 69444545 |
| Molecular Formula | C22H30N8O3 |
| Molecular Weight | 454.54 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | 9-(2,2-dimethylpropyl)-6-[2-(2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl)-2-oxoethyl]-7,8-dihydro-5H-pyrimido[4,5-e][1,4]diazepine-2-carbonitrile |
| SMILES | CC(C)(C)CN1CCN(CC(=O)N2CCC3(CC2)NC(=O)NC3=O)Cc2cnc(C#N)nc21 |
| InChI | InChI=1S/C22H30N8O3/c1-21(2,3)14-30-9-8-28(12-15-11-24-16(10-23)25-18(15)30)13-17(31)29-6-4-22(5-7-29)19(32)26-20(33)27-22/h11H,4-9,12-14H2,1-3H3,(H2,26,27,32,33) |
| InChIKey | BJYXBNXNCHZOLT-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 134.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.54 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|