C24H23N7O — CID 69445618
[4-[[5-[2-(1H-indazol-4-yl)ethenyl]pyrimidin-2-yl]amino]phenyl]-piperazin-1-ylmethanone (PubChem CID 69445618) has the molecular formula C24H23N7O and a molecular weight of 425.50 g/mol. Its IUPAC name is [4-[[5-[2-(1H-indazol-4-yl)ethenyl]pyrimidin-2-yl]amino]phenyl]-piperazin-1-ylmethanone.
| Compound Name | [4-[[5-[2-(1H-indazol-4-yl)ethenyl]pyrimidin-2-yl]amino]phenyl]-piperazin-1-ylmethanone |
|---|---|
| PubChem CID | 69445618 |
| Molecular Formula | C24H23N7O |
| Molecular Weight | 425.50 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | [4-[[5-[2-(1H-indazol-4-yl)ethenyl]pyrimidin-2-yl]amino]phenyl]-piperazin-1-ylmethanone |
| SMILES | O=C(c1ccc(Nc2ncc(C=Cc3cccc4[nH]ncc34)cn2)cc1)N1CCNCC1 |
| InChI | InChI=1S/C24H23N7O/c32-23(31-12-10-25-11-13-31)19-6-8-20(9-7-19)29-24-26-14-17(15-27-24)4-5-18-2-1-3-22-21(18)16-28-30-22/h1-9,14-16,25H,10-13H2,(H,28,30)(H,26,27,29) |
| InChIKey | GRYQGNLWSNEERL-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 98.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.50 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |