C24H29N3O2S — CID 69446151
methyl 1-[3-[4-(2-methylsulfanylphenyl)piperazin-1-yl]propyl]indole-3-carboxylate (PubChem CID 69446151) has the molecular formula C24H29N3O2S and a molecular weight of 423.58 g/mol. Its IUPAC name is methyl 1-[3-[4-(2-methylsulfanylphenyl)piperazin-1-yl]propyl]indole-3-carboxylate.
| Compound Name | methyl 1-[3-[4-(2-methylsulfanylphenyl)piperazin-1-yl]propyl]indole-3-carboxylate |
|---|---|
| PubChem CID | 69446151 |
| Molecular Formula | C24H29N3O2S |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | methyl 1-[3-[4-(2-methylsulfanylphenyl)piperazin-1-yl]propyl]indole-3-carboxylate |
| SMILES | COC(=O)c1cn(CCCN2CCN(c3ccccc3SC)CC2)c2ccccc12 |
| InChI | InChI=1S/C24H29N3O2S/c1-29-24(28)20-18-27(21-9-4-3-8-19(20)21)13-7-12-25-14-16-26(17-15-25)22-10-5-6-11-23(22)30-2/h3-6,8-11,18H,7,12-17H2,1-2H3 |
| InChIKey | FVVLTJGFTNUCAV-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 37.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |