C15H14N4O4S2 — CID 69447010
2-[(2-nitrophenyl)carbamoylamino]-5,7-dihydro-4H-thieno[2,3-c]thiopyran-3-carboxamide (PubChem CID 69447010) has the molecular formula C15H14N4O4S2 and a molecular weight of 378.44 g/mol. Its IUPAC name is 2-[(2-nitrophenyl)carbamoylamino]-5,7-dihydro-4H-thieno[2,3-c]thiopyran-3-carboxamide.
| Compound Name | 2-[(2-nitrophenyl)carbamoylamino]-5,7-dihydro-4H-thieno[2,3-c]thiopyran-3-carboxamide |
|---|---|
| PubChem CID | 69447010 |
| Molecular Formula | C15H14N4O4S2 |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | 2-[(2-nitrophenyl)carbamoylamino]-5,7-dihydro-4H-thieno[2,3-c]thiopyran-3-carboxamide |
| SMILES | NC(=O)c1c(NC(=O)Nc2ccccc2[N+](=O)[O-])sc2c1CCSC2 |
| InChI | InChI=1S/C15H14N4O4S2/c16-13(20)12-8-5-6-24-7-11(8)25-14(12)18-15(21)17-9-3-1-2-4-10(9)19(22)23/h1-4H,5-7H2,(H2,16,20)(H2,17,18,21) |
| InChIKey | ZUXZXXJFFDGHOK-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 127.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|