C16H24N4O3S2 — CID 69450599
2-(3-morpholin-4-ylpropylcarbamoylamino)-5,7-dihydro-4H-thieno[2,3-c]thiopyran-3-carboxamide (PubChem CID 69450599) has the molecular formula C16H24N4O3S2 and a molecular weight of 384.53 g/mol. Its IUPAC name is 2-(3-morpholin-4-ylpropylcarbamoylamino)-5,7-dihydro-4H-thieno[2,3-c]thiopyran-3-carboxamide.
| Compound Name | 2-(3-morpholin-4-ylpropylcarbamoylamino)-5,7-dihydro-4H-thieno[2,3-c]thiopyran-3-carboxamide |
|---|---|
| PubChem CID | 69450599 |
| Molecular Formula | C16H24N4O3S2 |
| Molecular Weight | 384.53 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | 2-(3-morpholin-4-ylpropylcarbamoylamino)-5,7-dihydro-4H-thieno[2,3-c]thiopyran-3-carboxamide |
| SMILES | NC(=O)c1c(NC(=O)NCCCN2CCOCC2)sc2c1CCSC2 |
| InChI | InChI=1S/C16H24N4O3S2/c17-14(21)13-11-2-9-24-10-12(11)25-15(13)19-16(22)18-3-1-4-20-5-7-23-8-6-20/h1-10H2,(H2,17,21)(H2,18,19,22) |
| InChIKey | CWFWQHTUGBQEGE-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.53 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|