C27H24N4O2 — CID 69447958
(3S)-3-[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one (PubChem CID 69447958) has the molecular formula C27H24N4O2 and a molecular weight of 436.52 g/mol. Its IUPAC name is (3S)-3-[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one.
| Compound Name | (3S)-3-[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 69447958 |
| Molecular Formula | C27H24N4O2 |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | (3S)-3-[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one |
| SMILES | CN1C(=O)[C@H](C(=O)[C@@H](N)Cc2c[nH]c3ccccc23)N=C(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C27H24N4O2/c1-31-23-14-8-6-12-20(23)24(17-9-3-2-4-10-17)30-25(27(31)33)26(32)21(28)15-18-16-29-22-13-7-5-11-19(18)22/h2-14,16,21,25,29H,15,28H2,1H3/t21-,25-/m0/s1 |
| InChIKey | OPDWDFGLWVJPPI-OFVILXPXSA-N |
| XLogP | 3.49 |
| TPSA | 91.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|