C30H37N3O3 — CID 69448030
3-cyclohexyl-1-(2-morpholin-2-yl-2-oxoethyl)-2-phenyl-N-propan-2-ylindole-6-carboxamide (PubChem CID 69448030) has the molecular formula C30H37N3O3 and a molecular weight of 487.64 g/mol. Its IUPAC name is 3-cyclohexyl-1-(2-morpholin-2-yl-2-oxoethyl)-2-phenyl-N-propan-2-ylindole-6-carboxamide.
| Compound Name | 3-cyclohexyl-1-(2-morpholin-2-yl-2-oxoethyl)-2-phenyl-N-propan-2-ylindole-6-carboxamide |
|---|---|
| PubChem CID | 69448030 |
| Molecular Formula | C30H37N3O3 |
| Molecular Weight | 487.64 g/mol |
| Exact Mass | 487.28 |
| IUPAC Name | 3-cyclohexyl-1-(2-morpholin-2-yl-2-oxoethyl)-2-phenyl-N-propan-2-ylindole-6-carboxamide |
| SMILES | CC(C)NC(=O)c1ccc2c(C3CCCCC3)c(-c3ccccc3)n(CC(=O)C3CNCCO3)c2c1 |
| InChI | InChI=1S/C30H37N3O3/c1-20(2)32-30(35)23-13-14-24-25(17-23)33(19-26(34)27-18-31-15-16-36-27)29(22-11-7-4-8-12-22)28(24)21-9-5-3-6-10-21/h4,7-8,11-14,17,20-21,27,31H,3,5-6,9-10,15-16,18-19H2,1-2H3,(H,32,35) |
| InChIKey | FHOWLRJXHHQPIA-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.64 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |