C30H25N3O2 — CID 69448715
N-[3-[[5-(3-phenylmethoxyphenyl)isoquinolin-1-yl]amino]phenyl]acetamide (PubChem CID 69448715) has the molecular formula C30H25N3O2 and a molecular weight of 459.55 g/mol. Its IUPAC name is N-[3-[[5-(3-phenylmethoxyphenyl)isoquinolin-1-yl]amino]phenyl]acetamide.
| Compound Name | N-[3-[[5-(3-phenylmethoxyphenyl)isoquinolin-1-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 69448715 |
| Molecular Formula | C30H25N3O2 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | N-[3-[[5-(3-phenylmethoxyphenyl)isoquinolin-1-yl]amino]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(Nc2nccc3c(-c4cccc(OCc5ccccc5)c4)cccc23)c1 |
| InChI | InChI=1S/C30H25N3O2/c1-21(34)32-24-11-6-12-25(19-24)33-30-29-15-7-14-27(28(29)16-17-31-30)23-10-5-13-26(18-23)35-20-22-8-3-2-4-9-22/h2-19H,20H2,1H3,(H,31,33)(H,32,34) |
| InChIKey | AMCUQHAVWKIFEH-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |