C24H17N3O6 — CID 69450606
2-(7-nitro-3-oxo-1,2-dihydroisoindol-4-yl)-5-phenylmethoxyindole-1-carboxylic acid (PubChem CID 69450606) has the molecular formula C24H17N3O6 and a molecular weight of 443.42 g/mol. Its IUPAC name is 2-(7-nitro-3-oxo-1,2-dihydroisoindol-4-yl)-5-phenylmethoxyindole-1-carboxylic acid.
| Compound Name | 2-(7-nitro-3-oxo-1,2-dihydroisoindol-4-yl)-5-phenylmethoxyindole-1-carboxylic acid |
|---|---|
| PubChem CID | 69450606 |
| Molecular Formula | C24H17N3O6 |
| Molecular Weight | 443.42 g/mol |
| Exact Mass | 443.11 |
| IUPAC Name | 2-(7-nitro-3-oxo-1,2-dihydroisoindol-4-yl)-5-phenylmethoxyindole-1-carboxylic acid |
| SMILES | O=C1NCc2c([N+](=O)[O-])ccc(-c3cc4cc(OCc5ccccc5)ccc4n3C(=O)O)c21 |
| InChI | InChI=1S/C24H17N3O6/c28-23-22-17(7-9-20(27(31)32)18(22)12-25-23)21-11-15-10-16(6-8-19(15)26(21)24(29)30)33-13-14-4-2-1-3-5-14/h1-11H,12-13H2,(H,25,28)(H,29,30) |
| InChIKey | UNOHXMZHWFKKDW-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 123.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.42 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|