C25H24ClN3O3 — CID 86628229
tert-butyl 2-(7-chloro-3-oxo-1,2-dihydroisoindol-4-yl)-5-[(prop-2-ynylamino)methyl]indole-1-carboxylate (PubChem CID 86628229) has the molecular formula C25H24ClN3O3 and a molecular weight of 449.94 g/mol. Its IUPAC name is tert-butyl 2-(7-chloro-3-oxo-1,2-dihydroisoindol-4-yl)-5-[(prop-2-ynylamino)methyl]indole-1-carboxylate.
| Compound Name | tert-butyl 2-(7-chloro-3-oxo-1,2-dihydroisoindol-4-yl)-5-[(prop-2-ynylamino)methyl]indole-1-carboxylate |
|---|---|
| PubChem CID | 86628229 |
| Molecular Formula | C25H24ClN3O3 |
| Molecular Weight | 449.94 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | tert-butyl 2-(7-chloro-3-oxo-1,2-dihydroisoindol-4-yl)-5-[(prop-2-ynylamino)methyl]indole-1-carboxylate |
| SMILES | C#CCNCc1ccc2c(c1)cc(-c1ccc(Cl)c3c1C(=O)NC3)n2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H24ClN3O3/c1-5-10-27-13-15-6-9-20-16(11-15)12-21(29(20)24(31)32-25(2,3)4)17-7-8-19(26)18-14-28-23(30)22(17)18/h1,6-9,11-12,27H,10,13-14H2,2-4H3,(H,28,30) |
| InChIKey | XBOQCBPXZOZXBN-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.94 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|