C31H34N4O7S — CID 86628310
tert-butyl 2-(6-methoxy-7-methylsulfonyloxy-3-oxo-1,2-dihydroisoindol-4-yl)-5-[(2-pyridin-2-ylethylamino)methyl]indole-1-carboxylate (PubChem CID 86628310) has the molecular formula C31H34N4O7S and a molecular weight of 606.70 g/mol. Its IUPAC name is tert-butyl 2-(6-methoxy-7-methylsulfonyloxy-3-oxo-1,2-dihydroisoindol-4-yl)-5-[(2-pyridin-2-ylethylamino)methyl]indole-1-carboxylate.
| Compound Name | tert-butyl 2-(6-methoxy-7-methylsulfonyloxy-3-oxo-1,2-dihydroisoindol-4-yl)-5-[(2-pyridin-2-ylethylamino)methyl]indole-1-carboxylate |
|---|---|
| PubChem CID | 86628310 |
| Molecular Formula | C31H34N4O7S |
| Molecular Weight | 606.70 g/mol |
| Exact Mass | 606.21 |
| IUPAC Name | tert-butyl 2-(6-methoxy-7-methylsulfonyloxy-3-oxo-1,2-dihydroisoindol-4-yl)-5-[(2-pyridin-2-ylethylamino)methyl]indole-1-carboxylate |
| SMILES | COc1cc(-c2cc3cc(CNCCc4ccccn4)ccc3n2C(=O)OC(C)(C)C)c2c(c1OS(C)(=O)=O)CNC2=O |
| InChI | InChI=1S/C31H34N4O7S/c1-31(2,3)41-30(37)35-24-10-9-19(17-32-13-11-21-8-6-7-12-33-21)14-20(24)15-25(35)22-16-26(40-4)28(42-43(5,38)39)23-18-34-29(36)27(22)23/h6-10,12,14-16,32H,11,13,17-18H2,1-5H3,(H,34,36) |
| InChIKey | IFMYDRGTXMIHBW-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 137.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.70 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|