C20H26N6O3 — CID 69451145
3-[[1-(3-amino-1-cyclopropyl-8-methoxy-2,4-dioxoquinazolin-7-yl)pyrrolidin-3-yl]methylamino]propanenitrile (PubChem CID 69451145) has the molecular formula C20H26N6O3 and a molecular weight of 398.47 g/mol. Its IUPAC name is 3-[[1-(3-amino-1-cyclopropyl-8-methoxy-2,4-dioxoquinazolin-7-yl)pyrrolidin-3-yl]methylamino]propanenitrile.
| Compound Name | 3-[[1-(3-amino-1-cyclopropyl-8-methoxy-2,4-dioxoquinazolin-7-yl)pyrrolidin-3-yl]methylamino]propanenitrile |
|---|---|
| PubChem CID | 69451145 |
| Molecular Formula | C20H26N6O3 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 3-[[1-(3-amino-1-cyclopropyl-8-methoxy-2,4-dioxoquinazolin-7-yl)pyrrolidin-3-yl]methylamino]propanenitrile |
| SMILES | COc1c(N2CCC(CNCCC#N)C2)ccc2c(=O)n(N)c(=O)n(C3CC3)c12 |
| InChI | InChI=1S/C20H26N6O3/c1-29-18-16(24-10-7-13(12-24)11-23-9-2-8-21)6-5-15-17(18)25(14-3-4-14)20(28)26(22)19(15)27/h5-6,13-14,23H,2-4,7,9-12,22H2,1H3 |
| InChIKey | REYWQDVMJVELNF-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 118.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|