C20H26N6O3 — CID 69451149
3-[[(3-amino-1-cyclopropyl-8-methoxy-2,4-dioxoquinazolin-7-yl)-pyrrolidin-3-ylmethyl]amino]propanenitrile (PubChem CID 69451149) has the molecular formula C20H26N6O3 and a molecular weight of 398.47 g/mol. Its IUPAC name is 3-[[(3-amino-1-cyclopropyl-8-methoxy-2,4-dioxoquinazolin-7-yl)-pyrrolidin-3-ylmethyl]amino]propanenitrile.
| Compound Name | 3-[[(3-amino-1-cyclopropyl-8-methoxy-2,4-dioxoquinazolin-7-yl)-pyrrolidin-3-ylmethyl]amino]propanenitrile |
|---|---|
| PubChem CID | 69451149 |
| Molecular Formula | C20H26N6O3 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 3-[[(3-amino-1-cyclopropyl-8-methoxy-2,4-dioxoquinazolin-7-yl)-pyrrolidin-3-ylmethyl]amino]propanenitrile |
| SMILES | COc1c(C(NCCC#N)C2CCNC2)ccc2c(=O)n(N)c(=O)n(C3CC3)c12 |
| InChI | InChI=1S/C20H26N6O3/c1-29-18-14(16(24-9-2-8-21)12-7-10-23-11-12)5-6-15-17(18)25(13-3-4-13)20(28)26(22)19(15)27/h5-6,12-13,16,23-24H,2-4,7,9-11,22H2,1H3 |
| InChIKey | BNLVQTJMFCHHJO-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 127.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|