C16H13N2O4S- — CID 6945257
2-[(3-methoxybenzoyl)carbamothioylamino]benzoate (PubChem CID 6945257) has the molecular formula C16H13N2O4S- and a molecular weight of 329.36 g/mol. Its IUPAC name is 2-[(3-methoxybenzoyl)carbamothioylamino]benzoate.
| Compound Name | 2-[(3-methoxybenzoyl)carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 6945257 |
| Molecular Formula | C16H13N2O4S- |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | 2-[(3-methoxybenzoyl)carbamothioylamino]benzoate |
| SMILES | COc1cccc(C(=O)NC(=S)Nc2ccccc2C(=O)[O-])c1 |
| InChI | InChI=1S/C16H14N2O4S/c1-22-11-6-4-5-10(9-11)14(19)18-16(23)17-13-8-3-2-7-12(13)15(20)21/h2-9H,1H3,(H,20,21)(H2,17,18,19,23)/p-1 |
| InChIKey | GPDBSGNPGAINNF-UHFFFAOYSA-M |
| XLogP | 1.19 |
| TPSA | 90.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|