C22H29N7O2 — CID 69452906
[3-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]imidazo[4,5-b]pyridin-2-yl]urea (PubChem CID 69452906) has the molecular formula C22H29N7O2 and a molecular weight of 423.52 g/mol. Its IUPAC name is [3-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]imidazo[4,5-b]pyridin-2-yl]urea.
| Compound Name | [3-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]imidazo[4,5-b]pyridin-2-yl]urea |
|---|---|
| PubChem CID | 69452906 |
| Molecular Formula | C22H29N7O2 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | [3-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]imidazo[4,5-b]pyridin-2-yl]urea |
| SMILES | COc1ccccc1N1CCN(CCCCn2c(NC(N)=O)nc3cccnc32)CC1 |
| InChI | InChI=1S/C22H29N7O2/c1-31-19-9-3-2-8-18(19)28-15-13-27(14-16-28)11-4-5-12-29-20-17(7-6-10-24-20)25-22(29)26-21(23)30/h2-3,6-10H,4-5,11-16H2,1H3,(H3,23,25,26,30) |
| InChIKey | MXLYBQNEKBSTMS-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 101.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|