C26H32N4O5 — CID 23176302
3-(4-quinolin-8-ylpiperazin-1-yl)propyl N-(3,4,5-trimethoxyphenyl)carbamate (PubChem CID 23176302) has the molecular formula C26H32N4O5 and a molecular weight of 480.57 g/mol. Its IUPAC name is 3-(4-quinolin-8-ylpiperazin-1-yl)propyl N-(3,4,5-trimethoxyphenyl)carbamate.
| Compound Name | 3-(4-quinolin-8-ylpiperazin-1-yl)propyl N-(3,4,5-trimethoxyphenyl)carbamate |
|---|---|
| PubChem CID | 23176302 |
| Molecular Formula | C26H32N4O5 |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.24 |
| IUPAC Name | 3-(4-quinolin-8-ylpiperazin-1-yl)propyl N-(3,4,5-trimethoxyphenyl)carbamate |
| SMILES | COc1cc(NC(=O)OCCCN2CCN(c3cccc4cccnc34)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C26H32N4O5/c1-32-22-17-20(18-23(33-2)25(22)34-3)28-26(31)35-16-6-11-29-12-14-30(15-13-29)21-9-4-7-19-8-5-10-27-24(19)21/h4-5,7-10,17-18H,6,11-16H2,1-3H3,(H,28,31) |
| InChIKey | BZBAKXNSYSFXQG-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 85.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|