C23H30FN3O4 — CID 12838128
ethyl N-[4-[3-[4-(3-fluorophenyl)piperazin-1-yl]propoxy]-3-methoxyphenyl]carbamate (PubChem CID 12838128) has the molecular formula C23H30FN3O4 and a molecular weight of 431.51 g/mol. Its IUPAC name is ethyl N-[4-[3-[4-(3-fluorophenyl)piperazin-1-yl]propoxy]-3-methoxyphenyl]carbamate.
| Compound Name | ethyl N-[4-[3-[4-(3-fluorophenyl)piperazin-1-yl]propoxy]-3-methoxyphenyl]carbamate |
|---|---|
| PubChem CID | 12838128 |
| Molecular Formula | C23H30FN3O4 |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | ethyl N-[4-[3-[4-(3-fluorophenyl)piperazin-1-yl]propoxy]-3-methoxyphenyl]carbamate |
| SMILES | CCOC(=O)Nc1ccc(OCCCN2CCN(c3cccc(F)c3)CC2)c(OC)c1 |
| InChI | InChI=1S/C23H30FN3O4/c1-3-30-23(28)25-19-8-9-21(22(17-19)29-2)31-15-5-10-26-11-13-27(14-12-26)20-7-4-6-18(24)16-20/h4,6-9,16-17H,3,5,10-15H2,1-2H3,(H,25,28) |
| InChIKey | MXBJCMXYHHRMRB-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|