C14H21BN3O3 — CID 71043377
CID 71043377 (PubChem CID 71043377) has the molecular formula C14H21BN3O3 and a molecular weight of 290.15 g/mol.
| Compound Name | CID 71043377 |
|---|---|
| PubChem CID | 71043377 |
| Molecular Formula | C14H21BN3O3 |
| Molecular Weight | 290.15 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | — |
| SMILES | CCOC(=O)Nc1cccc(N2CCN([B]OC)CC2)c1 |
| InChI | InChI=1S/C14H21BN3O3/c1-3-21-14(19)16-12-5-4-6-13(11-12)17-7-9-18(10-8-17)15-20-2/h4-6,11H,3,7-10H2,1-2H3,(H,16,19) |
| InChIKey | NUWFLJVPLLWHSK-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.15 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|