C17H18N6O — CID 69454772
5-[(2-aminoethylamino)methyl]-8-(1H-pyrrol-2-yl)-2H-[1,2,4]triazolo[4,3-a]quinolin-1-one (PubChem CID 69454772) has the molecular formula C17H18N6O and a molecular weight of 322.37 g/mol. Its IUPAC name is 5-[(2-aminoethylamino)methyl]-8-(1H-pyrrol-2-yl)-2H-[1,2,4]triazolo[4,3-a]quinolin-1-one.
| Compound Name | 5-[(2-aminoethylamino)methyl]-8-(1H-pyrrol-2-yl)-2H-[1,2,4]triazolo[4,3-a]quinolin-1-one |
|---|---|
| PubChem CID | 69454772 |
| Molecular Formula | C17H18N6O |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | 5-[(2-aminoethylamino)methyl]-8-(1H-pyrrol-2-yl)-2H-[1,2,4]triazolo[4,3-a]quinolin-1-one |
| SMILES | NCCNCc1cc2n[nH]c(=O)n2c2cc(-c3ccc[nH]3)ccc12 |
| InChI | InChI=1S/C17H18N6O/c18-5-7-19-10-12-9-16-21-22-17(24)23(16)15-8-11(3-4-13(12)15)14-2-1-6-20-14/h1-4,6,8-9,19-20H,5,7,10,18H2,(H,22,24) |
| InChIKey | YFNPHEKWXODPOP-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 104.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|