C19H22N6O — CID 69454833
5-[[2-(dimethylamino)ethylamino]methyl]-8-(1H-pyrrol-2-yl)-2H-[1,2,4]triazolo[4,3-a]quinolin-1-one (PubChem CID 69454833) has the molecular formula C19H22N6O and a molecular weight of 350.43 g/mol. Its IUPAC name is 5-[[2-(dimethylamino)ethylamino]methyl]-8-(1H-pyrrol-2-yl)-2H-[1,2,4]triazolo[4,3-a]quinolin-1-one.
| Compound Name | 5-[[2-(dimethylamino)ethylamino]methyl]-8-(1H-pyrrol-2-yl)-2H-[1,2,4]triazolo[4,3-a]quinolin-1-one |
|---|---|
| PubChem CID | 69454833 |
| Molecular Formula | C19H22N6O |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | 5-[[2-(dimethylamino)ethylamino]methyl]-8-(1H-pyrrol-2-yl)-2H-[1,2,4]triazolo[4,3-a]quinolin-1-one |
| SMILES | CN(C)CCNCc1cc2n[nH]c(=O)n2c2cc(-c3ccc[nH]3)ccc12 |
| InChI | InChI=1S/C19H22N6O/c1-24(2)9-8-20-12-14-11-18-22-23-19(26)25(18)17-10-13(5-6-15(14)17)16-4-3-7-21-16/h3-7,10-11,20-21H,8-9,12H2,1-2H3,(H,23,26) |
| InChIKey | DIIHJOQKVFMGIF-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|