C17H17N5O2 — CID 69453726
5-[(2-hydroxyethylamino)methyl]-8-(1H-pyrrol-2-yl)-2H-[1,2,4]triazolo[4,3-a]quinolin-1-one (PubChem CID 69453726) has the molecular formula C17H17N5O2 and a molecular weight of 323.36 g/mol. Its IUPAC name is 5-[(2-hydroxyethylamino)methyl]-8-(1H-pyrrol-2-yl)-2H-[1,2,4]triazolo[4,3-a]quinolin-1-one.
| Compound Name | 5-[(2-hydroxyethylamino)methyl]-8-(1H-pyrrol-2-yl)-2H-[1,2,4]triazolo[4,3-a]quinolin-1-one |
|---|---|
| PubChem CID | 69453726 |
| Molecular Formula | C17H17N5O2 |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | 5-[(2-hydroxyethylamino)methyl]-8-(1H-pyrrol-2-yl)-2H-[1,2,4]triazolo[4,3-a]quinolin-1-one |
| SMILES | O=c1[nH]nc2cc(CNCCO)c3ccc(-c4ccc[nH]4)cc3n12 |
| InChI | InChI=1S/C17H17N5O2/c23-7-6-18-10-12-9-16-20-21-17(24)22(16)15-8-11(3-4-13(12)15)14-2-1-5-19-14/h1-5,8-9,18-19,23H,6-7,10H2,(H,21,24) |
| InChIKey | ISEPBKWNVGNJKF-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|