C20H24N6O — CID 69455831
5-[[3-(dimethylamino)propylamino]methyl]-8-(1H-pyrrol-2-yl)-2H-[1,2,4]triazolo[4,3-a]quinolin-1-one (PubChem CID 69455831) has the molecular formula C20H24N6O and a molecular weight of 364.45 g/mol. Its IUPAC name is 5-[[3-(dimethylamino)propylamino]methyl]-8-(1H-pyrrol-2-yl)-2H-[1,2,4]triazolo[4,3-a]quinolin-1-one.
| Compound Name | 5-[[3-(dimethylamino)propylamino]methyl]-8-(1H-pyrrol-2-yl)-2H-[1,2,4]triazolo[4,3-a]quinolin-1-one |
|---|---|
| PubChem CID | 69455831 |
| Molecular Formula | C20H24N6O |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | 5-[[3-(dimethylamino)propylamino]methyl]-8-(1H-pyrrol-2-yl)-2H-[1,2,4]triazolo[4,3-a]quinolin-1-one |
| SMILES | CN(C)CCCNCc1cc2n[nH]c(=O)n2c2cc(-c3ccc[nH]3)ccc12 |
| InChI | InChI=1S/C20H24N6O/c1-25(2)10-4-8-21-13-15-12-19-23-24-20(27)26(19)18-11-14(6-7-16(15)18)17-5-3-9-22-17/h3,5-7,9,11-12,21-22H,4,8,10,13H2,1-2H3,(H,24,27) |
| InChIKey | MJRDQBBBTINMDF-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|