C25H21N7O — CID 69457262
2-(furan-2-yl)-6-[2-[1-(quinolin-3-ylmethyl)pyrrolidin-2-yl]ethynyl]-[1,2,4]triazolo[1,5-a]pyrazin-8-amine (PubChem CID 69457262) has the molecular formula C25H21N7O and a molecular weight of 435.49 g/mol. Its IUPAC name is 2-(furan-2-yl)-6-[2-[1-(quinolin-3-ylmethyl)pyrrolidin-2-yl]ethynyl]-[1,2,4]triazolo[1,5-a]pyrazin-8-amine.
| Compound Name | 2-(furan-2-yl)-6-[2-[1-(quinolin-3-ylmethyl)pyrrolidin-2-yl]ethynyl]-[1,2,4]triazolo[1,5-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 69457262 |
| Molecular Formula | C25H21N7O |
| Molecular Weight | 435.49 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | 2-(furan-2-yl)-6-[2-[1-(quinolin-3-ylmethyl)pyrrolidin-2-yl]ethynyl]-[1,2,4]triazolo[1,5-a]pyrazin-8-amine |
| SMILES | Nc1nc(C#CC2CCCN2Cc2cnc3ccccc3c2)cn2nc(-c3ccco3)nc12 |
| InChI | InChI=1S/C25H21N7O/c26-23-25-29-24(22-8-4-12-33-22)30-32(25)16-19(28-23)9-10-20-6-3-11-31(20)15-17-13-18-5-1-2-7-21(18)27-14-17/h1-2,4-5,7-8,12-14,16,20H,3,6,11,15H2,(H2,26,28) |
| InChIKey | DILCTHZAYASNFR-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 98.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.49 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|