C12H20N3O3+ — CID 6945864
1-[(3R)-1-ethyl-2,5-dioxopyrrolidin-3-yl]piperidin-1-ium-4-carboxamide (PubChem CID 6945864) has the molecular formula C12H20N3O3+ and a molecular weight of 254.31 g/mol. Its IUPAC name is 1-[(3R)-1-ethyl-2,5-dioxopyrrolidin-3-yl]piperidin-1-ium-4-carboxamide.
| Compound Name | 1-[(3R)-1-ethyl-2,5-dioxopyrrolidin-3-yl]piperidin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 6945864 |
| Molecular Formula | C12H20N3O3+ |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 1-[(3R)-1-ethyl-2,5-dioxopyrrolidin-3-yl]piperidin-1-ium-4-carboxamide |
| SMILES | CCN1C(=O)C[C@@H]([NH+]2CCC(C(N)=O)CC2)C1=O |
| InChI | InChI=1S/C12H19N3O3/c1-2-15-10(16)7-9(12(15)18)14-5-3-8(4-6-14)11(13)17/h8-9H,2-7H2,1H3,(H2,13,17)/p+1/t9-/m1/s1 |
| InChIKey | WJQSOAVUYCKQHE-SECBINFHSA-O |
| XLogP | -2.09 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|