C9H13N3O2 — CID 69463244
2-(4-amino-1-methoxypyrrolo[2,3-b]pyrrol-6-yl)ethanol (PubChem CID 69463244) has the molecular formula C9H13N3O2 and a molecular weight of 195.22 g/mol. Its IUPAC name is 2-(4-amino-1-methoxypyrrolo[2,3-b]pyrrol-6-yl)ethanol.
| Compound Name | 2-(4-amino-1-methoxypyrrolo[2,3-b]pyrrol-6-yl)ethanol |
|---|---|
| PubChem CID | 69463244 |
| Molecular Formula | C9H13N3O2 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | 2-(4-amino-1-methoxypyrrolo[2,3-b]pyrrol-6-yl)ethanol |
| SMILES | COn1ccc2c(N)cn(CCO)c21 |
| InChI | InChI=1S/C9H13N3O2/c1-14-12-3-2-7-8(10)6-11(4-5-13)9(7)12/h2-3,6,13H,4-5,10H2,1H3 |
| InChIKey | OHIHNFFSZBNXLS-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 65.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |