C12H15NO — CID 83944885
2-(4,7-dimethylindol-1-yl)ethanol (PubChem CID 83944885) has the molecular formula C12H15NO and a molecular weight of 189.26 g/mol. Its IUPAC name is 2-(4,7-dimethylindol-1-yl)ethanol.
| Compound Name | 2-(4,7-dimethylindol-1-yl)ethanol |
|---|---|
| PubChem CID | 83944885 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | 2-(4,7-dimethylindol-1-yl)ethanol |
| SMILES | Cc1ccc(C)c2c1ccn2CCO |
| InChI | InChI=1S/C12H15NO/c1-9-3-4-10(2)12-11(9)5-6-13(12)7-8-14/h3-6,14H,7-8H2,1-2H3 |
| InChIKey | XNQTZUSEAATTMG-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |