C17H13F3N4O — CID 69464674
3-(1H-imidazol-2-ylamino)-2-phenyl-5-(trifluoromethyl)benzamide (PubChem CID 69464674) has the molecular formula C17H13F3N4O and a molecular weight of 346.31 g/mol. Its IUPAC name is 3-(1H-imidazol-2-ylamino)-2-phenyl-5-(trifluoromethyl)benzamide.
| Compound Name | 3-(1H-imidazol-2-ylamino)-2-phenyl-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 69464674 |
| Molecular Formula | C17H13F3N4O |
| Molecular Weight | 346.31 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 3-(1H-imidazol-2-ylamino)-2-phenyl-5-(trifluoromethyl)benzamide |
| SMILES | NC(=O)c1cc(C(F)(F)F)cc(Nc2ncc[nH]2)c1-c1ccccc1 |
| InChI | InChI=1S/C17H13F3N4O/c18-17(19,20)11-8-12(15(21)25)14(10-4-2-1-3-5-10)13(9-11)24-16-22-6-7-23-16/h1-9H,(H2,21,25)(H2,22,23,24) |
| InChIKey | NXRNERPDVJJTOL-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.31 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |