C12H13ILiNO3S — CID 69464715
lithium 3-iodo-2-(1-methylsulfanylpropan-2-ylcarbamoyl)benzoate (PubChem CID 69464715) has the molecular formula C12H13ILiNO3S and a molecular weight of 385.15 g/mol. Its IUPAC name is lithium 3-iodo-2-(1-methylsulfanylpropan-2-ylcarbamoyl)benzoate.
| Compound Name | lithium 3-iodo-2-(1-methylsulfanylpropan-2-ylcarbamoyl)benzoate |
|---|---|
| PubChem CID | 69464715 |
| Molecular Formula | C12H13ILiNO3S |
| Molecular Weight | 385.15 g/mol |
| Exact Mass | 384.98 |
| IUPAC Name | lithium 3-iodo-2-(1-methylsulfanylpropan-2-ylcarbamoyl)benzoate |
| SMILES | CSCC(C)NC(=O)c1c(I)cccc1C(=O)[O-].[Li+] |
| InChI | InChI=1S/C12H14INO3S.Li/c1-7(6-18-2)14-11(15)10-8(12(16)17)4-3-5-9(10)13;/h3-5,7H,6H2,1-2H3,(H,14,15)(H,16,17);/q;+1/p-1 |
| InChIKey | GWBKAOLYHPEQNC-UHFFFAOYSA-M |
| XLogP | -1.86 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.15 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|