C32H30ClNO3S — CID 69466111
4-chloro-N-[(2S)-5-hydroxy-2-methyl-5,5-dinaphthalen-1-ylpentyl]benzenesulfonamide (PubChem CID 69466111) has the molecular formula C32H30ClNO3S and a molecular weight of 544.12 g/mol. Its IUPAC name is 4-chloro-N-[(2S)-5-hydroxy-2-methyl-5,5-dinaphthalen-1-ylpentyl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[(2S)-5-hydroxy-2-methyl-5,5-dinaphthalen-1-ylpentyl]benzenesulfonamide |
|---|---|
| PubChem CID | 69466111 |
| Molecular Formula | C32H30ClNO3S |
| Molecular Weight | 544.12 g/mol |
| Exact Mass | 543.16 |
| IUPAC Name | 4-chloro-N-[(2S)-5-hydroxy-2-methyl-5,5-dinaphthalen-1-ylpentyl]benzenesulfonamide |
| SMILES | C[C@@H](CCC(O)(c1cccc2ccccc12)c1cccc2ccccc12)CNS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C32H30ClNO3S/c1-23(22-34-38(36,37)27-18-16-26(33)17-19-27)20-21-32(35,30-14-6-10-24-8-2-4-12-28(24)30)31-15-7-11-25-9-3-5-13-29(25)31/h2-19,23,34-35H,20-22H2,1H3/t23-/m0/s1 |
| InChIKey | IWQJXKHXQZQBJP-QHCPKHFHSA-N |
| XLogP | 7.28 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.12 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |