C22H24ClN2O2S+ — CID 8701743
4-chloro-N-[(2R)-2-naphthalen-1-yl-2-pyrrolidin-1-ium-1-ylethyl]benzenesulfonamide (PubChem CID 8701743) has the molecular formula C22H24ClN2O2S+ and a molecular weight of 415.97 g/mol. Its IUPAC name is 4-chloro-N-[(2R)-2-naphthalen-1-yl-2-pyrrolidin-1-ium-1-ylethyl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[(2R)-2-naphthalen-1-yl-2-pyrrolidin-1-ium-1-ylethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 8701743 |
| Molecular Formula | C22H24ClN2O2S+ |
| Molecular Weight | 415.97 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | 4-chloro-N-[(2R)-2-naphthalen-1-yl-2-pyrrolidin-1-ium-1-ylethyl]benzenesulfonamide |
| SMILES | O=S(=O)(NC[C@@H](c1cccc2ccccc12)[NH+]1CCCC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H23ClN2O2S/c23-18-10-12-19(13-11-18)28(26,27)24-16-22(25-14-3-4-15-25)21-9-5-7-17-6-1-2-8-20(17)21/h1-2,5-13,22,24H,3-4,14-16H2/p+1/t22-/m0/s1 |
| InChIKey | SKPZHSIRVXUDIP-QFIPXVFZSA-O |
| XLogP | 3.19 |
| TPSA | 50.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.97 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |