C17H17NO2S2 — CID 694666
6-ethoxy-2-[(4-methoxyphenyl)methylsulfanyl]-1,3-benzothiazole (PubChem CID 694666) has the molecular formula C17H17NO2S2 and a molecular weight of 331.46 g/mol. Its IUPAC name is 6-ethoxy-2-[(4-methoxyphenyl)methylsulfanyl]-1,3-benzothiazole.
| Compound Name | 6-ethoxy-2-[(4-methoxyphenyl)methylsulfanyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 694666 |
| Molecular Formula | C17H17NO2S2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | 6-ethoxy-2-[(4-methoxyphenyl)methylsulfanyl]-1,3-benzothiazole |
| SMILES | CCOc1ccc2nc(SCc3ccc(OC)cc3)sc2c1 |
| InChI | InChI=1S/C17H17NO2S2/c1-3-20-14-8-9-15-16(10-14)22-17(18-15)21-11-12-4-6-13(19-2)7-5-12/h4-10H,3,11H2,1-2H3 |
| InChIKey | AXJKWRKFGZTAHP-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |