C22H24N4O6 — CID 69468584
tert-butyl 4-[6-[(2-methylphenyl)carbamoyloxy]-3-pyridinyl]-3,5-dioxopiperazine-1-carboxylate (PubChem CID 69468584) has the molecular formula C22H24N4O6 and a molecular weight of 440.46 g/mol. Its IUPAC name is tert-butyl 4-[6-[(2-methylphenyl)carbamoyloxy]-3-pyridinyl]-3,5-dioxopiperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[6-[(2-methylphenyl)carbamoyloxy]-3-pyridinyl]-3,5-dioxopiperazine-1-carboxylate |
|---|---|
| PubChem CID | 69468584 |
| Molecular Formula | C22H24N4O6 |
| Molecular Weight | 440.46 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | tert-butyl 4-[6-[(2-methylphenyl)carbamoyloxy]-3-pyridinyl]-3,5-dioxopiperazine-1-carboxylate |
| SMILES | Cc1ccccc1NC(=O)Oc1ccc(N2C(=O)CN(C(=O)OC(C)(C)C)CC2=O)cn1 |
| InChI | InChI=1S/C22H24N4O6/c1-14-7-5-6-8-16(14)24-20(29)31-17-10-9-15(11-23-17)26-18(27)12-25(13-19(26)28)21(30)32-22(2,3)4/h5-11H,12-13H2,1-4H3,(H,24,29) |
| InChIKey | HZGSXDICQXZYAL-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 118.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.46 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|