C28H33NO3 — CID 162395339
tert-butyl (3E,5E)-3,5-bis[(2,6-dimethylphenyl)methylidene]-4-oxopiperidine-1-carboxylate (PubChem CID 162395339) has the molecular formula C28H33NO3 and a molecular weight of 431.58 g/mol. Its IUPAC name is tert-butyl (3E,5E)-3,5-bis[(2,6-dimethylphenyl)methylidene]-4-oxopiperidine-1-carboxylate.
| Compound Name | tert-butyl (3E,5E)-3,5-bis[(2,6-dimethylphenyl)methylidene]-4-oxopiperidine-1-carboxylate |
|---|---|
| PubChem CID | 162395339 |
| Molecular Formula | C28H33NO3 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.25 |
| IUPAC Name | tert-butyl (3E,5E)-3,5-bis[(2,6-dimethylphenyl)methylidene]-4-oxopiperidine-1-carboxylate |
| SMILES | Cc1cccc(C)c1/C=C1\CN(C(=O)OC(C)(C)C)C/C(=C\c2c(C)cccc2C)C1=O |
| InChI | InChI=1S/C28H33NO3/c1-18-10-8-11-19(2)24(18)14-22-16-29(27(31)32-28(5,6)7)17-23(26(22)30)15-25-20(3)12-9-13-21(25)4/h8-15H,16-17H2,1-7H3/b22-14+,23-15+ |
| InChIKey | FABYENNDTZGZGY-HOFJZWJUSA-N |
| XLogP | 6.21 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|