C20H21NO5 — CID 155564477
tert-butyl (3E)-3,5-bis(furan-3-ylmethylidene)-4-oxopiperidine-1-carboxylate (PubChem CID 155564477) has the molecular formula C20H21NO5 and a molecular weight of 355.39 g/mol. Its IUPAC name is tert-butyl (3E)-3,5-bis(furan-3-ylmethylidene)-4-oxopiperidine-1-carboxylate.
| Compound Name | tert-butyl (3E)-3,5-bis(furan-3-ylmethylidene)-4-oxopiperidine-1-carboxylate |
|---|---|
| PubChem CID | 155564477 |
| Molecular Formula | C20H21NO5 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | tert-butyl (3E)-3,5-bis(furan-3-ylmethylidene)-4-oxopiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(=Cc2ccoc2)C(=O)/C(=C/c2ccoc2)C1 |
| InChI | InChI=1S/C20H21NO5/c1-20(2,3)26-19(23)21-10-16(8-14-4-6-24-12-14)18(22)17(11-21)9-15-5-7-25-13-15/h4-9,12-13H,10-11H2,1-3H3/b16-8+,17-9? |
| InChIKey | NORLJDKDMFTHLF-BNHMHCSBSA-N |
| XLogP | 4.16 |
| TPSA | 72.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|