C17H26N4O2S — CID 53273933
tert-butyl 4-[(2-methylphenyl)carbamothioylamino]piperazine-1-carboxylate (PubChem CID 53273933) has the molecular formula C17H26N4O2S and a molecular weight of 350.49 g/mol. Its IUPAC name is tert-butyl 4-[(2-methylphenyl)carbamothioylamino]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[(2-methylphenyl)carbamothioylamino]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 53273933 |
| Molecular Formula | C17H26N4O2S |
| Molecular Weight | 350.49 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | tert-butyl 4-[(2-methylphenyl)carbamothioylamino]piperazine-1-carboxylate |
| SMILES | Cc1ccccc1NC(=S)NN1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C17H26N4O2S/c1-13-7-5-6-8-14(13)18-15(24)19-21-11-9-20(10-12-21)16(22)23-17(2,3)4/h5-8H,9-12H2,1-4H3,(H2,18,19,24) |
| InChIKey | QLARZZGSTZPNGH-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.49 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|