C17H36N2O3Si — CID 69470629
[1-[4-[tert-butyl(dimethyl)silyl]oxycyclohexyl]-3-(methylamino)propan-2-yl]carbamic acid (PubChem CID 69470629) has the molecular formula C17H36N2O3Si and a molecular weight of 344.57 g/mol. Its IUPAC name is [1-[4-[tert-butyl(dimethyl)silyl]oxycyclohexyl]-3-(methylamino)propan-2-yl]carbamic acid.
| Compound Name | [1-[4-[tert-butyl(dimethyl)silyl]oxycyclohexyl]-3-(methylamino)propan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 69470629 |
| Molecular Formula | C17H36N2O3Si |
| Molecular Weight | 344.57 g/mol |
| Exact Mass | 344.25 |
| IUPAC Name | [1-[4-[tert-butyl(dimethyl)silyl]oxycyclohexyl]-3-(methylamino)propan-2-yl]carbamic acid |
| SMILES | CNCC(CC1CCC(O[Si](C)(C)C(C)(C)C)CC1)NC(=O)O |
| InChI | InChI=1S/C17H36N2O3Si/c1-17(2,3)23(5,6)22-15-9-7-13(8-10-15)11-14(12-18-4)19-16(20)21/h13-15,18-19H,7-12H2,1-6H3,(H,20,21) |
| InChIKey | QDYNPQXVCKAANR-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.57 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|