C9H10N2O5 — CID 69470783
2-(carboxymethoxy)-2-(pyridin-2-ylamino)acetic acid (PubChem CID 69470783) has the molecular formula C9H10N2O5 and a molecular weight of 226.19 g/mol. Its IUPAC name is 2-(carboxymethoxy)-2-(pyridin-2-ylamino)acetic acid.
| Compound Name | 2-(carboxymethoxy)-2-(pyridin-2-ylamino)acetic acid |
|---|---|
| PubChem CID | 69470783 |
| Molecular Formula | C9H10N2O5 |
| Molecular Weight | 226.19 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | 2-(carboxymethoxy)-2-(pyridin-2-ylamino)acetic acid |
| SMILES | O=C(O)COC(Nc1ccccn1)C(=O)O |
| InChI | InChI=1S/C9H10N2O5/c12-7(13)5-16-8(9(14)15)11-6-3-1-2-4-10-6/h1-4,8H,5H2,(H,10,11)(H,12,13)(H,14,15) |
| InChIKey | HWKFPEVEGMGYDO-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.19 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|