C27H26N2O2 — CID 69472546
2-[phenyl-(4-quinolin-8-ylphenyl)methoxy]pentanamide (PubChem CID 69472546) has the molecular formula C27H26N2O2 and a molecular weight of 410.52 g/mol. Its IUPAC name is 2-[phenyl-(4-quinolin-8-ylphenyl)methoxy]pentanamide.
| Compound Name | 2-[phenyl-(4-quinolin-8-ylphenyl)methoxy]pentanamide |
|---|---|
| PubChem CID | 69472546 |
| Molecular Formula | C27H26N2O2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | 2-[phenyl-(4-quinolin-8-ylphenyl)methoxy]pentanamide |
| SMILES | CCCC(OC(c1ccccc1)c1ccc(-c2cccc3cccnc23)cc1)C(N)=O |
| InChI | InChI=1S/C27H26N2O2/c1-2-8-24(27(28)30)31-26(21-9-4-3-5-10-21)22-16-14-19(15-17-22)23-13-6-11-20-12-7-18-29-25(20)23/h3-7,9-18,24,26H,2,8H2,1H3,(H2,28,30) |
| InChIKey | MXAYTBMRQNWYNG-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |