C26H39N3O4 — CID 69473269
4-[[1-[(1-ethylpyrrolidin-2-yl)methyl]-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]cyclohexane-1-carboxylic acid (PubChem CID 69473269) has the molecular formula C26H39N3O4 and a molecular weight of 457.62 g/mol. Its IUPAC name is 4-[[1-[(1-ethylpyrrolidin-2-yl)methyl]-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[1-[(1-ethylpyrrolidin-2-yl)methyl]-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 69473269 |
| Molecular Formula | C26H39N3O4 |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.29 |
| IUPAC Name | 4-[[1-[(1-ethylpyrrolidin-2-yl)methyl]-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]cyclohexane-1-carboxylic acid |
| SMILES | CCN1CCCC1Cn1c2c(cc(C(=O)NC3CCC(C(=O)O)CC3)c1=O)CCCCCC2 |
| InChI | InChI=1S/C26H39N3O4/c1-2-28-15-7-9-21(28)17-29-23-10-6-4-3-5-8-19(23)16-22(25(29)31)24(30)27-20-13-11-18(12-14-20)26(32)33/h16,18,20-21H,2-15,17H2,1H3,(H,27,30)(H,32,33) |
| InChIKey | JWFGEHNUIJZGQX-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 91.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |