C26H39N3O5 — CID 67519761
2-[[2-[[1-(cyclohexylmethyl)-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]-2-methylpropanoyl]-methylamino]acetic acid (PubChem CID 67519761) has the molecular formula C26H39N3O5 and a molecular weight of 473.61 g/mol. Its IUPAC name is 2-[[2-[[1-(cyclohexylmethyl)-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]-2-methylpropanoyl]-methylamino]acetic acid.
| Compound Name | 2-[[2-[[1-(cyclohexylmethyl)-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]-2-methylpropanoyl]-methylamino]acetic acid |
|---|---|
| PubChem CID | 67519761 |
| Molecular Formula | C26H39N3O5 |
| Molecular Weight | 473.61 g/mol |
| Exact Mass | 473.29 |
| IUPAC Name | 2-[[2-[[1-(cyclohexylmethyl)-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]-2-methylpropanoyl]-methylamino]acetic acid |
| SMILES | CN(CC(=O)O)C(=O)C(C)(C)NC(=O)c1cc2c(n(CC3CCCCC3)c1=O)CCCCCC2 |
| InChI | InChI=1S/C26H39N3O5/c1-26(2,25(34)28(3)17-22(30)31)27-23(32)20-15-19-13-9-4-5-10-14-21(19)29(24(20)33)16-18-11-7-6-8-12-18/h15,18H,4-14,16-17H2,1-3H3,(H,27,32)(H,30,31) |
| InChIKey | QMISJELUCWJKOX-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 108.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.61 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |