C26H38N2O4 — CID 163808988
1-(cyclohexylmethyl)-3-[(2S)-2-(3-methoxyoxiran-2-yl)pyrrolidine-1-carbonyl]-5,6,7,8,9,10-hexahydrocycloocta[b]pyridin-2-one (PubChem CID 163808988) has the molecular formula C26H38N2O4 and a molecular weight of 442.60 g/mol. Its IUPAC name is 1-(cyclohexylmethyl)-3-[(2S)-2-(3-methoxyoxiran-2-yl)pyrrolidine-1-carbonyl]-5,6,7,8,9,10-hexahydrocycloocta[b]pyridin-2-one.
| Compound Name | 1-(cyclohexylmethyl)-3-[(2S)-2-(3-methoxyoxiran-2-yl)pyrrolidine-1-carbonyl]-5,6,7,8,9,10-hexahydrocycloocta[b]pyridin-2-one |
|---|---|
| PubChem CID | 163808988 |
| Molecular Formula | C26H38N2O4 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.28 |
| IUPAC Name | 1-(cyclohexylmethyl)-3-[(2S)-2-(3-methoxyoxiran-2-yl)pyrrolidine-1-carbonyl]-5,6,7,8,9,10-hexahydrocycloocta[b]pyridin-2-one |
| SMILES | COC1OC1[C@@H]1CCCN1C(=O)c1cc2c(n(CC3CCCCC3)c1=O)CCCCCC2 |
| InChI | InChI=1S/C26H38N2O4/c1-31-26-23(32-26)22-14-9-15-27(22)24(29)20-16-19-12-7-2-3-8-13-21(19)28(25(20)30)17-18-10-5-4-6-11-18/h16,18,22-23,26H,2-15,17H2,1H3/t22-,23?,26?/m0/s1 |
| InChIKey | NLPIKRZXDWFXAD-MFNHVEPQSA-N |
| XLogP | 4.06 |
| TPSA | 64.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|